C26H41N3O2 — CID 67157390
(5S)-3,3-dimethyl-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-5-(piperidin-1-ylmethyl)pyrrolidin-2-one (PubChem CID 67157390) has the molecular formula C26H41N3O2 and a molecular weight of 427.63 g/mol. Its IUPAC name is (5S)-3,3-dimethyl-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-5-(piperidin-1-ylmethyl)pyrrolidin-2-one.
| Compound Name | (5S)-3,3-dimethyl-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-5-(piperidin-1-ylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 67157390 |
| Molecular Formula | C26H41N3O2 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.32 |
| IUPAC Name | (5S)-3,3-dimethyl-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-5-(piperidin-1-ylmethyl)pyrrolidin-2-one |
| SMILES | CC1CCCN1CCCOc1ccc(N2C(=O)C(C)(C)C[C@H]2CN2CCCCC2)cc1 |
| InChI | InChI=1S/C26H41N3O2/c1-21-9-7-16-28(21)17-8-18-31-24-12-10-22(11-13-24)29-23(19-26(2,3)25(29)30)20-27-14-5-4-6-15-27/h10-13,21,23H,4-9,14-20H2,1-3H3/t21?,23-/m0/s1 |
| InChIKey | QROZUBPCGAVYPP-YANBTOMASA-N |
| XLogP | 4.56 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|