C24H37N3O2 — CID 16663172
(5S)-5-[(cyclopentylamino)methyl]-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyrrolidin-2-one (PubChem CID 16663172) has the molecular formula C24H37N3O2 and a molecular weight of 399.58 g/mol. Its IUPAC name is (5S)-5-[(cyclopentylamino)methyl]-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[(cyclopentylamino)methyl]-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 16663172 |
| Molecular Formula | C24H37N3O2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | (5S)-5-[(cyclopentylamino)methyl]-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyrrolidin-2-one |
| SMILES | CC1CCCN1CCCOc1ccc(N2C(=O)CC[C@H]2CNC2CCCC2)cc1 |
| InChI | InChI=1S/C24H37N3O2/c1-19-6-4-15-26(19)16-5-17-29-23-12-9-21(10-13-23)27-22(11-14-24(27)28)18-25-20-7-2-3-8-20/h9-10,12-13,19-20,22,25H,2-8,11,14-18H2,1H3/t19?,22-/m0/s1 |
| InChIKey | UGEOYQWKKZKFMS-BPARTEKVSA-N |
| XLogP | 3.97 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|