C25H31FN2O3 — CID 16662783
(5S)-5-[(4-fluorophenoxy)methyl]-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyrrolidin-2-one (PubChem CID 16662783) has the molecular formula C25H31FN2O3 and a molecular weight of 426.53 g/mol. Its IUPAC name is (5S)-5-[(4-fluorophenoxy)methyl]-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[(4-fluorophenoxy)methyl]-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 16662783 |
| Molecular Formula | C25H31FN2O3 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (5S)-5-[(4-fluorophenoxy)methyl]-1-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]pyrrolidin-2-one |
| SMILES | CC1CCCN1CCCOc1ccc(N2C(=O)CC[C@H]2COc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H31FN2O3/c1-19-4-2-15-27(19)16-3-17-30-23-12-7-21(8-13-23)28-22(9-14-25(28)29)18-31-24-10-5-20(26)6-11-24/h5-8,10-13,19,22H,2-4,9,14-18H2,1H3/t19?,22-/m0/s1 |
| InChIKey | IBFHYDXRQKVRQD-BPARTEKVSA-N |
| XLogP | 4.65 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|