C33H37N3O6S — CID 59127598
tert-butyl (2S,4R)-2-[[(1R)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamothioyl]-4-(7-methoxy-2-phenylquinolin-4-yl)oxypyrrolidine-1-carboxylate (PubChem CID 59127598) has the molecular formula C33H37N3O6S and a molecular weight of 603.74 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[[(1R)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamothioyl]-4-(7-methoxy-2-phenylquinolin-4-yl)oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[[(1R)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamothioyl]-4-(7-methoxy-2-phenylquinolin-4-yl)oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59127598 |
| Molecular Formula | C33H37N3O6S |
| Molecular Weight | 603.74 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | tert-butyl (2S,4R)-2-[[(1R)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamothioyl]-4-(7-methoxy-2-phenylquinolin-4-yl)oxypyrrolidine-1-carboxylate |
| SMILES | C=CC1C[C@]1(NC(=S)[C@@H]1C[C@@H](Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)CN1C(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C33H37N3O6S/c1-7-21-18-33(21,30(37)40-6)35-29(43)27-16-23(19-36(27)31(38)42-32(2,3)4)41-28-17-25(20-11-9-8-10-12-20)34-26-15-22(39-5)13-14-24(26)28/h7-15,17,21,23,27H,1,16,18-19H2,2-6H3,(H,35,43)/t21?,23-,27+,33-/m1/s1 |
| InChIKey | XPMKTZWZZSYWSS-SFJJVGLASA-N |
| XLogP | 5.70 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.74 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|