C29H33N5O8 — CID 91191884
tert-butyl (2S,4R)-4-[2-(2-diazoacetyl)-7-methoxyquinolin-4-yl]oxy-2-[[(1R,2S)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 91191884) has the molecular formula C29H33N5O8 and a molecular weight of 579.61 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[2-(2-diazoacetyl)-7-methoxyquinolin-4-yl]oxy-2-[[(1R,2S)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[2-(2-diazoacetyl)-7-methoxyquinolin-4-yl]oxy-2-[[(1R,2S)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91191884 |
| Molecular Formula | C29H33N5O8 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | tert-butyl (2S,4R)-4-[2-(2-diazoacetyl)-7-methoxyquinolin-4-yl]oxy-2-[[(1R,2S)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](Oc2cc(C(=O)C=[N+]=[N-])nc3cc(OC)ccc23)CN1C(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C29H33N5O8/c1-7-16-13-29(16,26(37)40-6)33-25(36)22-11-18(15-34(22)27(38)42-28(2,3)4)41-24-12-21(23(35)14-31-30)32-20-10-17(39-5)8-9-19(20)24/h7-10,12,14,16,18,22H,1,11,13,15H2,2-6H3,(H,33,36)/t16-,18-,22+,29-/m1/s1 |
| InChIKey | YZXPUGJQOWVUAX-CCGHDIGVSA-N |
| XLogP | 2.72 |
| TPSA | 169.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|