C19H33N2O7P — CID 59127633
tert-butyl (2S,4R)-2-[[(1S,2S)-1-diethoxyphosphoryl-2-ethenylcyclopropyl]carbamoyl]-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 59127633) has the molecular formula C19H33N2O7P and a molecular weight of 432.45 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[[(1S,2S)-1-diethoxyphosphoryl-2-ethenylcyclopropyl]carbamoyl]-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[[(1S,2S)-1-diethoxyphosphoryl-2-ethenylcyclopropyl]carbamoyl]-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59127633 |
| Molecular Formula | C19H33N2O7P |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | tert-butyl (2S,4R)-2-[[(1S,2S)-1-diethoxyphosphoryl-2-ethenylcyclopropyl]carbamoyl]-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](O)CN1C(=O)OC(C)(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C19H33N2O7P/c1-7-13-11-19(13,29(25,26-8-2)27-9-3)20-16(23)15-10-14(22)12-21(15)17(24)28-18(4,5)6/h7,13-15,22H,1,8-12H2,2-6H3,(H,20,23)/t13-,14-,15+,19+/m1/s1 |
| InChIKey | DLFXCSLRHHJBDO-CUYVQJCZSA-N |
| XLogP | 2.64 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|