C16H22N2O6 — CID 89145443
prop-1-en-2-yl (2S)-2-[[(1R,2S)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 89145443) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is prop-1-en-2-yl (2S)-2-[[(1R,2S)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | prop-1-en-2-yl (2S)-2-[[(1R,2S)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 89145443 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | prop-1-en-2-yl (2S)-2-[[(1R,2S)-2-ethenyl-1-methoxycarbonylcyclopropyl]carbamoyl]-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CC(O)CN1C(=O)OC(=C)C)C(=O)OC |
| InChI | InChI=1S/C16H22N2O6/c1-5-10-7-16(10,14(21)23-4)17-13(20)12-6-11(19)8-18(12)15(22)24-9(2)3/h5,10-12,19H,1-2,6-8H2,3-4H3,(H,17,20)/t10-,11?,12+,16-/m1/s1 |
| InChIKey | LLMWHYJYDGAQNH-UDAOKRHPSA-N |
| XLogP | 0.33 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|