C59H52F3N5O4 — CID 59127982
methyl 2-[[2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]-3-(1-tritylimidazol-4-yl)propanoate (PubChem CID 59127982) has the molecular formula C59H52F3N5O4 and a molecular weight of 952.09 g/mol. Its IUPAC name is methyl 2-[[2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]-3-(1-tritylimidazol-4-yl)propanoate.
| Compound Name | methyl 2-[[2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]-3-(1-tritylimidazol-4-yl)propanoate |
|---|---|
| PubChem CID | 59127982 |
| Molecular Formula | C59H52F3N5O4 |
| Molecular Weight | 952.09 g/mol |
| Exact Mass | 951.40 |
| IUPAC Name | methyl 2-[[2-phenyl-2-[1-[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]piperidin-4-yl]acetyl]amino]-3-(1-tritylimidazol-4-yl)propanoate |
| SMILES | COC(=O)C(Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)NC(=O)C(c1ccccc1)C1CCN(c2ccc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C59H52F3N5O4/c1-71-57(70)53(38-49-39-67(40-63-49)58(44-18-8-3-9-19-44,45-20-10-4-11-21-45)46-22-12-5-13-23-46)65-56(69)54(42-16-6-2-7-17-42)43-34-36-66(37-35-43)50-32-30-48(31-33-50)64-55(68)52-25-15-14-24-51(52)41-26-28-47(29-27-41)59(60,61)62/h2-33,39-40,43,53-54H,34-38H2,1H3,(H,64,68)(H,65,69) |
| InChIKey | UGRDEZBXVTZKEC-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.09 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|