C24H33ClN2O4 — CID 59128244
1-[(1R,2S,13S,14S,16S,17R,18S,20S)-1-chloro-17,20-dihydroxy-2,6,16,18-tetramethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4,7,9-trien-17-yl]-2-hydroxyethanone (PubChem CID 59128244) has the molecular formula C24H33ClN2O4 and a molecular weight of 448.99 g/mol. Its IUPAC name is 1-[(1R,2S,13S,14S,16S,17R,18S,20S)-1-chloro-17,20-dihydroxy-2,6,16,18-tetramethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4,7,9-trien-17-yl]-2-hydroxyethanone.
| Compound Name | 1-[(1R,2S,13S,14S,16S,17R,18S,20S)-1-chloro-17,20-dihydroxy-2,6,16,18-tetramethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4,7,9-trien-17-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 59128244 |
| Molecular Formula | C24H33ClN2O4 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 1-[(1R,2S,13S,14S,16S,17R,18S,20S)-1-chloro-17,20-dihydroxy-2,6,16,18-tetramethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4,7,9-trien-17-yl]-2-hydroxyethanone |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CCC4=Cc5nn(C)cc5C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)CO |
| InChI | InChI=1S/C24H33ClN2O4/c1-13-7-17-16-6-5-15-8-18-14(11-27(4)26-18)9-21(15,2)23(16,25)19(29)10-22(17,3)24(13,31)20(30)12-28/h8,11,13,16-17,19,28-29,31H,5-7,9-10,12H2,1-4H3/t13-,16-,17-,19-,21-,22-,23-,24-/m0/s1 |
| InChIKey | FCGZITWJVSJYIE-ICAWJIOWSA-N |
| XLogP | 2.47 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|