C28H27N7O2 — CID 59128538
N-[2-[[2-phenyl-6-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 59128538) has the molecular formula C28H27N7O2 and a molecular weight of 493.57 g/mol. Its IUPAC name is N-[2-[[2-phenyl-6-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-phenyl-6-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 59128538 |
| Molecular Formula | C28H27N7O2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N-[2-[[2-phenyl-6-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc(-c2ccccc2)nc2[nH]c(C(=O)N3CCc4c([nH]c5ccccc45)C3)cc12 |
| InChI | InChI=1S/C28H27N7O2/c1-17(36)29-12-13-30-26-21-15-23(32-27(21)34-25(33-26)18-7-3-2-4-8-18)28(37)35-14-11-20-19-9-5-6-10-22(19)31-24(20)16-35/h2-10,15,31H,11-14,16H2,1H3,(H,29,36)(H2,30,32,33,34) |
| InChIKey | IUJGDQZEQDRDQP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|