C17H18N6O2 — CID 70932286
4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 70932286) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 70932286 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CC(=O)NCCNc1nc(-c2ccccc2)nc2[nH]c(C(N)=O)cc12 |
| InChI | InChI=1S/C17H18N6O2/c1-10(24)19-7-8-20-16-12-9-13(14(18)25)21-17(12)23-15(22-16)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H2,18,25)(H,19,24)(H2,20,21,22,23) |
| InChIKey | CTMADUTUKXBIAE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|