C25H32N8O4 — CID 68563261
[1-[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidine-6-carbonyl]-4-(ethylamino)piperidin-4-yl] carbamate (PubChem CID 68563261) has the molecular formula C25H32N8O4 and a molecular weight of 508.58 g/mol. Its IUPAC name is [1-[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidine-6-carbonyl]-4-(ethylamino)piperidin-4-yl] carbamate.
| Compound Name | [1-[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidine-6-carbonyl]-4-(ethylamino)piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 68563261 |
| Molecular Formula | C25H32N8O4 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | [1-[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidine-6-carbonyl]-4-(ethylamino)piperidin-4-yl] carbamate |
| SMILES | CCNC1(OC(N)=O)CCN(C(=O)c2cc3c(NCCNC(C)=O)nc(-c4ccccc4)nc3[nH]2)CC1 |
| InChI | InChI=1S/C25H32N8O4/c1-3-29-25(37-24(26)36)9-13-33(14-10-25)23(35)19-15-18-21(28-12-11-27-16(2)34)31-20(32-22(18)30-19)17-7-5-4-6-8-17/h4-8,15,29H,3,9-14H2,1-2H3,(H2,26,36)(H,27,34)(H2,28,30,31,32) |
| InChIKey | WOALBDROGKXXAK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|