C31H30N6O4 — CID 141245625
ethyl 1-[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidine-6-carbonyl]-4-phenylpyridine-4-carboxylate (PubChem CID 141245625) has the molecular formula C31H30N6O4 and a molecular weight of 550.62 g/mol. Its IUPAC name is ethyl 1-[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidine-6-carbonyl]-4-phenylpyridine-4-carboxylate.
| Compound Name | ethyl 1-[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidine-6-carbonyl]-4-phenylpyridine-4-carboxylate |
|---|---|
| PubChem CID | 141245625 |
| Molecular Formula | C31H30N6O4 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | ethyl 1-[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidine-6-carbonyl]-4-phenylpyridine-4-carboxylate |
| SMILES | CCOC(=O)C1(c2ccccc2)C=CN(C(=O)c2cc3c(NCCNC(C)=O)nc(-c4ccccc4)nc3[nH]2)C=C1 |
| InChI | InChI=1S/C31H30N6O4/c1-3-41-30(40)31(23-12-8-5-9-13-23)14-18-37(19-15-31)29(39)25-20-24-27(33-17-16-32-21(2)38)35-26(36-28(24)34-25)22-10-6-4-7-11-22/h4-15,18-20H,3,16-17H2,1-2H3,(H,32,38)(H2,33,34,35,36) |
| InChIKey | CVKFJHBEWKUSGH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|