C29H26N6O3 — CID 141245599
N-[2-[[6-(4-formyl-4-phenylpyridine-1-carbonyl)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 141245599) has the molecular formula C29H26N6O3 and a molecular weight of 506.57 g/mol. Its IUPAC name is N-[2-[[6-(4-formyl-4-phenylpyridine-1-carbonyl)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[6-(4-formyl-4-phenylpyridine-1-carbonyl)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 141245599 |
| Molecular Formula | C29H26N6O3 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | N-[2-[[6-(4-formyl-4-phenylpyridine-1-carbonyl)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc(-c2ccccc2)nc2[nH]c(C(=O)N3C=CC(C=O)(c4ccccc4)C=C3)cc12 |
| InChI | InChI=1S/C29H26N6O3/c1-20(37)30-14-15-31-26-23-18-24(32-27(23)34-25(33-26)21-8-4-2-5-9-21)28(38)35-16-12-29(19-36,13-17-35)22-10-6-3-7-11-22/h2-13,16-19H,14-15H2,1H3,(H,30,37)(H2,31,32,33,34) |
| InChIKey | RJSAJZXCLOQHCD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|