C19H21N5O3 — CID 71056150
3-[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-yl]propanoic acid (PubChem CID 71056150) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-yl]propanoic acid.
| Compound Name | 3-[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 71056150 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3-[4-(2-acetamidoethylamino)-2-phenyl-7H-pyrrolo[2,3-d]pyrimidin-6-yl]propanoic acid |
| SMILES | CC(=O)NCCNc1nc(-c2ccccc2)nc2[nH]c(CCC(=O)O)cc12 |
| InChI | InChI=1S/C19H21N5O3/c1-12(25)20-9-10-21-18-15-11-14(7-8-16(26)27)22-19(15)24-17(23-18)13-5-3-2-4-6-13/h2-6,11H,7-10H2,1H3,(H,20,25)(H,26,27)(H2,21,22,23,24) |
| InChIKey | YCCLJRQCSGISAE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|