C10H17Cm2NO4-2 — CID 59130181
curium;2-(heptan-4-yloxycarbonylamino)acetic acid (PubChem CID 59130181) has the molecular formula C10H17Cm2NO4-2 and a molecular weight of 709.25 g/mol. Its IUPAC name is curium;2-(heptan-4-yloxycarbonylamino)acetic acid.
| Compound Name | curium;2-(heptan-4-yloxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 59130181 |
| Molecular Formula | C10H17Cm2NO4-2 |
| Molecular Weight | 709.25 g/mol |
| Exact Mass | 701.24 |
| IUPAC Name | curium;2-(heptan-4-yloxycarbonylamino)acetic acid |
| SMILES | [CH2-]CCC(CC[CH2-])OC(=O)NCC(=O)O.[Cm].[Cm] |
| InChI | InChI=1S/C10H17NO4.2Cm/c1-3-5-8(6-4-2)15-10(14)11-7-9(12)13;;/h8H,1-7H2,(H,11,14)(H,12,13);;/q-2;; |
| InChIKey | TZOLUIKRWAIMDM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|