C25H27FN6O4 — CID 59130269
6-[[[(1R,5R)-3-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-8-oxa-3-azabicyclo[3.2.1]octan-6-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 59130269) has the molecular formula C25H27FN6O4 and a molecular weight of 494.53 g/mol. Its IUPAC name is 6-[[[(1R,5R)-3-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-8-oxa-3-azabicyclo[3.2.1]octan-6-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[[[(1R,5R)-3-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-8-oxa-3-azabicyclo[3.2.1]octan-6-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 59130269 |
| Molecular Formula | C25H27FN6O4 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 6-[[[(1R,5R)-3-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-8-oxa-3-azabicyclo[3.2.1]octan-6-yl]amino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | COc1ccc2ncc(F)c(CCN3C[C@H]4CC(NCc5ccc6c(n5)NC(=O)CO6)[C@@H](C3)O4)c2n1 |
| InChI | InChI=1S/C25H27FN6O4/c1-34-23-5-3-18-24(31-23)16(17(26)10-28-18)6-7-32-11-15-8-19(21(12-32)36-15)27-9-14-2-4-20-25(29-14)30-22(33)13-35-20/h2-5,10,15,19,21,27H,6-9,11-13H2,1H3,(H,29,30,33)/t15-,19?,21-/m1/s1 |
| InChIKey | WAIIQGBZPHILQX-RGWUMTFWSA-N |
| XLogP | 1.68 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |