C26H28FN7O4 — CID 143159682
6-[[[(5R)-3-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-7-hydroxyimino-3-azabicyclo[4.1.0]heptan-5-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 143159682) has the molecular formula C26H28FN7O4 and a molecular weight of 521.55 g/mol. Its IUPAC name is 6-[[[(5R)-3-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-7-hydroxyimino-3-azabicyclo[4.1.0]heptan-5-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-[[[(5R)-3-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-7-hydroxyimino-3-azabicyclo[4.1.0]heptan-5-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 143159682 |
| Molecular Formula | C26H28FN7O4 |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 6-[[[(5R)-3-[2-(3-fluoro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-7-hydroxyimino-3-azabicyclo[4.1.0]heptan-5-yl]methylamino]methyl]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | COc1ccc2ncc(F)c(CCN3CC4C(=NO)C4[C@H](CNCc4ccc5c(n4)NC(=O)CO5)C3)c2n1 |
| InChI | InChI=1S/C26H28FN7O4/c1-37-22-5-3-19-24(32-22)16(18(27)10-29-19)6-7-34-11-14(23-17(12-34)25(23)33-36)8-28-9-15-2-4-20-26(30-15)31-21(35)13-38-20/h2-5,10,14,17,23,28,36H,6-9,11-13H2,1H3,(H,30,31,35)/t14-,17?,23?/m1/s1 |
| InChIKey | VHNLWTOCAKHQMF-JZYQJFMBSA-N |
| XLogP | 1.84 |
| TPSA | 134.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|