C29H22F5N3O2 — CID 59130808
2-(2,3-difluorophenyl)-5-[[4-[4-(2-methoxyethoxy)-2-(trifluoromethyl)phenyl]phenyl]methyl]imidazo[4,5-c]pyridine (PubChem CID 59130808) has the molecular formula C29H22F5N3O2 and a molecular weight of 539.50 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-5-[[4-[4-(2-methoxyethoxy)-2-(trifluoromethyl)phenyl]phenyl]methyl]imidazo[4,5-c]pyridine.
| Compound Name | 2-(2,3-difluorophenyl)-5-[[4-[4-(2-methoxyethoxy)-2-(trifluoromethyl)phenyl]phenyl]methyl]imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 59130808 |
| Molecular Formula | C29H22F5N3O2 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | 2-(2,3-difluorophenyl)-5-[[4-[4-(2-methoxyethoxy)-2-(trifluoromethyl)phenyl]phenyl]methyl]imidazo[4,5-c]pyridine |
| SMILES | COCCOc1ccc(-c2ccc(Cn3ccc4nc(-c5cccc(F)c5F)nc-4c3)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H22F5N3O2/c1-38-13-14-39-20-9-10-21(23(15-20)29(32,33)34)19-7-5-18(6-8-19)16-37-12-11-25-26(17-37)36-28(35-25)22-3-2-4-24(30)27(22)31/h2-12,15,17H,13-14,16H2,1H3 |
| InChIKey | NWARAUVQDMZKLG-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|