C13H25NO — CID 59130993
(3S,5R)-4-cyclohexyl-3,5-dimethylpiperidin-4-ol (PubChem CID 59130993) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (3S,5R)-4-cyclohexyl-3,5-dimethylpiperidin-4-ol.
| Compound Name | (3S,5R)-4-cyclohexyl-3,5-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 59130993 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (3S,5R)-4-cyclohexyl-3,5-dimethylpiperidin-4-ol |
| SMILES | C[C@@H]1CNC[C@H](C)C1(O)C1CCCCC1 |
| InChI | InChI=1S/C13H25NO/c1-10-8-14-9-11(2)13(10,15)12-6-4-3-5-7-12/h10-12,14-15H,3-9H2,1-2H3/t10-,11+,13? |
| InChIKey | ZMSWCCRHGOLLNU-QYJAPNMZSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |