C10H16F3NO — CID 98113046
(1R,6R)-10-(trifluoromethyl)-8-azabicyclo[4.3.1]decan-10-ol (PubChem CID 98113046) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is (1R,6R)-10-(trifluoromethyl)-8-azabicyclo[4.3.1]decan-10-ol.
| Compound Name | (1R,6R)-10-(trifluoromethyl)-8-azabicyclo[4.3.1]decan-10-ol |
|---|---|
| PubChem CID | 98113046 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (1R,6R)-10-(trifluoromethyl)-8-azabicyclo[4.3.1]decan-10-ol |
| SMILES | OC1(C(F)(F)F)[C@@H]2CCCC[C@@H]1CNC2 |
| InChI | InChI=1S/C10H16F3NO/c11-10(12,13)9(15)7-3-1-2-4-8(9)6-14-5-7/h7-8,14-15H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | SNGDXPDTHZGOQP-HTQZYQBOSA-N |
| XLogP | 1.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |