C24H36F2N2 — CID 59131190
(E)-N-[2-[1-(1-cyclohexylethyl)pyrrolidin-2-yl]ethyl]-3-(2,4-difluorophenyl)-2-methylprop-2-en-1-amine (PubChem CID 59131190) has the molecular formula C24H36F2N2 and a molecular weight of 390.56 g/mol. Its IUPAC name is (E)-N-[2-[1-(1-cyclohexylethyl)pyrrolidin-2-yl]ethyl]-3-(2,4-difluorophenyl)-2-methylprop-2-en-1-amine.
| Compound Name | (E)-N-[2-[1-(1-cyclohexylethyl)pyrrolidin-2-yl]ethyl]-3-(2,4-difluorophenyl)-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 59131190 |
| Molecular Formula | C24H36F2N2 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (E)-N-[2-[1-(1-cyclohexylethyl)pyrrolidin-2-yl]ethyl]-3-(2,4-difluorophenyl)-2-methylprop-2-en-1-amine |
| SMILES | C/C(=C\c1ccc(F)cc1F)CNCCC1CCCN1C(C)C1CCCCC1 |
| InChI | InChI=1S/C24H36F2N2/c1-18(15-21-10-11-22(25)16-24(21)26)17-27-13-12-23-9-6-14-28(23)19(2)20-7-4-3-5-8-20/h10-11,15-16,19-20,23,27H,3-9,12-14,17H2,1-2H3/b18-15+ |
| InChIKey | DFKNWGICUPYZHH-OBGWFSINSA-N |
| XLogP | 5.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|