C9H17N — CID 59131933
(3R,4aS,7aS)-3-methyl-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[c]pyridine (PubChem CID 59131933) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is (3R,4aS,7aS)-3-methyl-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[c]pyridine.
| Compound Name | (3R,4aS,7aS)-3-methyl-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[c]pyridine |
|---|---|
| PubChem CID | 59131933 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (3R,4aS,7aS)-3-methyl-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[c]pyridine |
| SMILES | C[C@@H]1C[C@@H]2CCC[C@@H]2CN1 |
| InChI | InChI=1S/C9H17N/c1-7-5-8-3-2-4-9(8)6-10-7/h7-10H,2-6H2,1H3/t7-,8+,9-/m1/s1 |
| InChIKey | ORRUHBWNOSPFNU-HRDYMLBCSA-N |
| XLogP | 1.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |