C13H22NO2P — CID 59132076
[3-[3-dimethylphosphorylpropyl(methyl)amino]phenyl]methanol (PubChem CID 59132076) has the molecular formula C13H22NO2P and a molecular weight of 255.30 g/mol. Its IUPAC name is [3-[3-dimethylphosphorylpropyl(methyl)amino]phenyl]methanol.
| Compound Name | [3-[3-dimethylphosphorylpropyl(methyl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 59132076 |
| Molecular Formula | C13H22NO2P |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | [3-[3-dimethylphosphorylpropyl(methyl)amino]phenyl]methanol |
| SMILES | CN(CCCP(C)(C)=O)c1cccc(CO)c1 |
| InChI | InChI=1S/C13H22NO2P/c1-14(8-5-9-17(2,3)16)13-7-4-6-12(10-13)11-15/h4,6-7,10,15H,5,8-9,11H2,1-3H3 |
| InChIKey | UFPKOSWFMMEEEW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|