C12H6Br4 — CID 591322
1,4-dibromo-2-(2,5-dibromophenyl)benzene (PubChem CID 591322) has the molecular formula C12H6Br4 and a molecular weight of 469.80 g/mol. Its IUPAC name is 1,4-dibromo-2-(2,5-dibromophenyl)benzene.
| Compound Name | 1,4-dibromo-2-(2,5-dibromophenyl)benzene |
|---|---|
| PubChem CID | 591322 |
| Molecular Formula | C12H6Br4 |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 465.72 |
| IUPAC Name | 1,4-dibromo-2-(2,5-dibromophenyl)benzene |
| SMILES | Brc1ccc(Br)c(-c2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C12H6Br4/c13-7-1-3-11(15)9(5-7)10-6-8(14)2-4-12(10)16/h1-6H |
| InChIKey | XEFMFJLRXHQLEM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |