C14H15NO4 — CID 59132728
ethyl 3-(4-hydroxyphenyl)-3-(1,2-oxazol-5-yl)propanoate (PubChem CID 59132728) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is ethyl 3-(4-hydroxyphenyl)-3-(1,2-oxazol-5-yl)propanoate.
| Compound Name | ethyl 3-(4-hydroxyphenyl)-3-(1,2-oxazol-5-yl)propanoate |
|---|---|
| PubChem CID | 59132728 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | ethyl 3-(4-hydroxyphenyl)-3-(1,2-oxazol-5-yl)propanoate |
| SMILES | CCOC(=O)CC(c1ccc(O)cc1)c1ccno1 |
| InChI | InChI=1S/C14H15NO4/c1-2-18-14(17)9-12(13-7-8-15-19-13)10-3-5-11(16)6-4-10/h3-8,12,16H,2,9H2,1H3 |
| InChIKey | HZWRGJHCZQZUNV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |