C28H22F3NO3 — CID 59132740
3-pyridin-3-yl-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 59132740) has the molecular formula C28H22F3NO3 and a molecular weight of 477.48 g/mol. Its IUPAC name is 3-pyridin-3-yl-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-pyridin-3-yl-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 59132740 |
| Molecular Formula | C28H22F3NO3 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 3-pyridin-3-yl-3-[4-[[3-[4-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CC(c1ccc(OCc2cccc(-c3ccc(C(F)(F)F)cc3)c2)cc1)c1cccnc1 |
| InChI | InChI=1S/C28H22F3NO3/c29-28(30,31)24-10-6-20(7-11-24)22-4-1-3-19(15-22)18-35-25-12-8-21(9-13-25)26(16-27(33)34)23-5-2-14-32-17-23/h1-15,17,26H,16,18H2,(H,33,34) |
| InChIKey | VFRUNWAYCWSCOV-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |