C34H38F6N2O6 — CID 59133270
5-[2-[4-carboxy-3-[[4-[(4-methylcyclohexyl)methyl]cyclohexyl]carbamoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(methylcarbamoyl)benzoic acid (PubChem CID 59133270) has the molecular formula C34H38F6N2O6 and a molecular weight of 684.67 g/mol. Its IUPAC name is 5-[2-[4-carboxy-3-[[4-[(4-methylcyclohexyl)methyl]cyclohexyl]carbamoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(methylcarbamoyl)benzoic acid.
| Compound Name | 5-[2-[4-carboxy-3-[[4-[(4-methylcyclohexyl)methyl]cyclohexyl]carbamoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(methylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 59133270 |
| Molecular Formula | C34H38F6N2O6 |
| Molecular Weight | 684.67 g/mol |
| Exact Mass | 684.26 |
| IUPAC Name | 5-[2-[4-carboxy-3-[[4-[(4-methylcyclohexyl)methyl]cyclohexyl]carbamoyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-(methylcarbamoyl)benzoic acid |
| SMILES | CNC(=O)c1ccc(C(c2ccc(C(=O)O)c(C(=O)NC3CCC(CC4CCC(C)CC4)CC3)c2)(C(F)(F)F)C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C34H38F6N2O6/c1-18-3-5-19(6-4-18)15-20-7-11-23(12-8-20)42-29(44)26-16-21(10-14-25(26)30(45)46)32(33(35,36)37,34(38,39)40)22-9-13-24(28(43)41-2)27(17-22)31(47)48/h9-10,13-14,16-20,23H,3-8,11-12,15H2,1-2H3,(H,41,43)(H,42,44)(H,45,46)(H,47,48) |
| InChIKey | FWCBHNAURHUHMZ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.67 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |