C19H24FN3O2 — CID 59134334
(3R,4S)-6,7-diamino-4-[2-(2-fluorophenyl)ethylamino]-2,2-dimethyl-3,4-dihydrochromen-3-ol (PubChem CID 59134334) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is (3R,4S)-6,7-diamino-4-[2-(2-fluorophenyl)ethylamino]-2,2-dimethyl-3,4-dihydrochromen-3-ol.
| Compound Name | (3R,4S)-6,7-diamino-4-[2-(2-fluorophenyl)ethylamino]-2,2-dimethyl-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 59134334 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (3R,4S)-6,7-diamino-4-[2-(2-fluorophenyl)ethylamino]-2,2-dimethyl-3,4-dihydrochromen-3-ol |
| SMILES | CC1(C)Oc2cc(N)c(N)cc2[C@H](NCCc2ccccc2F)[C@H]1O |
| InChI | InChI=1S/C19H24FN3O2/c1-19(2)18(24)17(12-9-14(21)15(22)10-16(12)25-19)23-8-7-11-5-3-4-6-13(11)20/h3-6,9-10,17-18,23-24H,7-8,21-22H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | TTWFUIMTBVVGQY-ZWKOTPCHSA-N |
| XLogP | 2.40 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|