C18H25N3O2 — CID 159014562
(8R)-7,7-dimethyl-9-(pentylamino)-8,9-dihydropyrano[2,3-g]quinoxalin-8-ol (PubChem CID 159014562) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (8R)-7,7-dimethyl-9-(pentylamino)-8,9-dihydropyrano[2,3-g]quinoxalin-8-ol.
| Compound Name | (8R)-7,7-dimethyl-9-(pentylamino)-8,9-dihydropyrano[2,3-g]quinoxalin-8-ol |
|---|---|
| PubChem CID | 159014562 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (8R)-7,7-dimethyl-9-(pentylamino)-8,9-dihydropyrano[2,3-g]quinoxalin-8-ol |
| SMILES | CCCCCNC1c2cc3nccnc3cc2OC(C)(C)[C@@H]1O |
| InChI | InChI=1S/C18H25N3O2/c1-4-5-6-7-21-16-12-10-13-14(20-9-8-19-13)11-15(12)23-18(2,3)17(16)22/h8-11,16-17,21-22H,4-7H2,1-3H3/t16?,17-/m1/s1 |
| InChIKey | JSXRAXHZNAUXQG-ZYMOGRSISA-N |
| XLogP | 2.98 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|