C22H37N3O6S — CID 10140155
N-[3-hydroxy-2,2-dimethyl-7-nitro-4-(pentylamino)-3,4-dihydrochromen-6-yl]hexane-1-sulfonamide (PubChem CID 10140155) has the molecular formula C22H37N3O6S and a molecular weight of 471.62 g/mol. Its IUPAC name is N-[3-hydroxy-2,2-dimethyl-7-nitro-4-(pentylamino)-3,4-dihydrochromen-6-yl]hexane-1-sulfonamide.
| Compound Name | N-[3-hydroxy-2,2-dimethyl-7-nitro-4-(pentylamino)-3,4-dihydrochromen-6-yl]hexane-1-sulfonamide |
|---|---|
| PubChem CID | 10140155 |
| Molecular Formula | C22H37N3O6S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-[3-hydroxy-2,2-dimethyl-7-nitro-4-(pentylamino)-3,4-dihydrochromen-6-yl]hexane-1-sulfonamide |
| SMILES | CCCCCCS(=O)(=O)Nc1cc2c(cc1[N+](=O)[O-])OC(C)(C)C(O)C2NCCCCC |
| InChI | InChI=1S/C22H37N3O6S/c1-5-7-9-11-13-32(29,30)24-17-14-16-19(15-18(17)25(27)28)31-22(3,4)21(26)20(16)23-12-10-8-6-2/h14-15,20-21,23-24,26H,5-13H2,1-4H3 |
| InChIKey | NRAFNKPWGVCQIE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|