C24H27ClN2O2 — CID 87449867
(3R,4S)-7-chloro-2,2,9-trimethyl-4-(3-phenylpropylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol (PubChem CID 87449867) has the molecular formula C24H27ClN2O2 and a molecular weight of 410.95 g/mol. Its IUPAC name is (3R,4S)-7-chloro-2,2,9-trimethyl-4-(3-phenylpropylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol.
| Compound Name | (3R,4S)-7-chloro-2,2,9-trimethyl-4-(3-phenylpropylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
|---|---|
| PubChem CID | 87449867 |
| Molecular Formula | C24H27ClN2O2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (3R,4S)-7-chloro-2,2,9-trimethyl-4-(3-phenylpropylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
| SMILES | Cc1cc(Cl)nc2cc3c(cc12)OC(C)(C)[C@H](O)[C@H]3NCCCc1ccccc1 |
| InChI | InChI=1S/C24H27ClN2O2/c1-15-12-21(25)27-19-13-18-20(14-17(15)19)29-24(2,3)23(28)22(18)26-11-7-10-16-8-5-4-6-9-16/h4-6,8-9,12-14,22-23,26,28H,7,10-11H2,1-3H3/t22-,23+/m0/s1 |
| InChIKey | HVQPLDFHLAONCL-XZOQPEGZSA-N |
| XLogP | 4.99 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|