C20H27ClN2O — CID 141123356
7-chloro-2,2,9-trimethyl-N-(3-methylbutyl)-3,4-dihydropyrano[2,3-g]quinolin-4-amine (PubChem CID 141123356) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is 7-chloro-2,2,9-trimethyl-N-(3-methylbutyl)-3,4-dihydropyrano[2,3-g]quinolin-4-amine.
| Compound Name | 7-chloro-2,2,9-trimethyl-N-(3-methylbutyl)-3,4-dihydropyrano[2,3-g]quinolin-4-amine |
|---|---|
| PubChem CID | 141123356 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 7-chloro-2,2,9-trimethyl-N-(3-methylbutyl)-3,4-dihydropyrano[2,3-g]quinolin-4-amine |
| SMILES | Cc1cc(Cl)nc2cc3c(cc12)OC(C)(C)CC3NCCC(C)C |
| InChI | InChI=1S/C20H27ClN2O/c1-12(2)6-7-22-17-11-20(4,5)24-18-10-14-13(3)8-19(21)23-16(14)9-15(17)18/h8-10,12,17,22H,6-7,11H2,1-5H3 |
| InChIKey | VVLWKEDXLLEFRC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|