C23H25ClN2O3 — CID 87450322
(3R,4S)-7-chloro-4-[(2-hydroxy-2-phenylethyl)amino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol (PubChem CID 87450322) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is (3R,4S)-7-chloro-4-[(2-hydroxy-2-phenylethyl)amino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol.
| Compound Name | (3R,4S)-7-chloro-4-[(2-hydroxy-2-phenylethyl)amino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
|---|---|
| PubChem CID | 87450322 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (3R,4S)-7-chloro-4-[(2-hydroxy-2-phenylethyl)amino]-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
| SMILES | Cc1cc(Cl)nc2cc3c(cc12)OC(C)(C)[C@H](O)[C@H]3NCC(O)c1ccccc1 |
| InChI | InChI=1S/C23H25ClN2O3/c1-13-9-20(24)26-17-10-16-19(11-15(13)17)29-23(2,3)22(28)21(16)25-12-18(27)14-7-5-4-6-8-14/h4-11,18,21-22,25,27-28H,12H2,1-3H3/t18?,21-,22+/m0/s1 |
| InChIKey | KBOCOAKGVSVDNO-LFZQMPOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|