C22H23ClN2O2 — CID 87323460
(1S,2R)-8-chloro-3,3-dimethyl-1-(2-phenylethylamino)-1,2-dihydropyrano[3,2-f]quinolin-2-ol (PubChem CID 87323460) has the molecular formula C22H23ClN2O2 and a molecular weight of 382.89 g/mol. Its IUPAC name is (1S,2R)-8-chloro-3,3-dimethyl-1-(2-phenylethylamino)-1,2-dihydropyrano[3,2-f]quinolin-2-ol.
| Compound Name | (1S,2R)-8-chloro-3,3-dimethyl-1-(2-phenylethylamino)-1,2-dihydropyrano[3,2-f]quinolin-2-ol |
|---|---|
| PubChem CID | 87323460 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (1S,2R)-8-chloro-3,3-dimethyl-1-(2-phenylethylamino)-1,2-dihydropyrano[3,2-f]quinolin-2-ol |
| SMILES | CC1(C)Oc2ccc3nc(Cl)ccc3c2[C@H](NCCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C22H23ClN2O2/c1-22(2)21(26)20(24-13-12-14-6-4-3-5-7-14)19-15-8-11-18(23)25-16(15)9-10-17(19)27-22/h3-11,20-21,24,26H,12-13H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | KZDQLNPOGAVNCL-LEWJYISDSA-N |
| XLogP | 4.29 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|