C20H21F3N2O4 — CID 46179173
2,2-dimethyl-6-nitro-4-(2-phenylethylamino)-5-(trifluoromethyl)-3,4-dihydrochromen-3-ol (PubChem CID 46179173) has the molecular formula C20H21F3N2O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is 2,2-dimethyl-6-nitro-4-(2-phenylethylamino)-5-(trifluoromethyl)-3,4-dihydrochromen-3-ol.
| Compound Name | 2,2-dimethyl-6-nitro-4-(2-phenylethylamino)-5-(trifluoromethyl)-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 46179173 |
| Molecular Formula | C20H21F3N2O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2,2-dimethyl-6-nitro-4-(2-phenylethylamino)-5-(trifluoromethyl)-3,4-dihydrochromen-3-ol |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])c(C(F)(F)F)c2C(NCCc2ccccc2)C1O |
| InChI | InChI=1S/C20H21F3N2O4/c1-19(2)18(26)17(24-11-10-12-6-4-3-5-7-12)15-14(29-19)9-8-13(25(27)28)16(15)20(21,22)23/h3-9,17-18,24,26H,10-11H2,1-2H3 |
| InChIKey | KOBJOZLHSAIPOA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|