C19H21ClN2O4 — CID 70916193
(3R,4S)-6-chloro-2,2-dimethyl-7-nitro-4-(2-phenylethylamino)-3,4-dihydrochromen-3-ol (PubChem CID 70916193) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is (3R,4S)-6-chloro-2,2-dimethyl-7-nitro-4-(2-phenylethylamino)-3,4-dihydrochromen-3-ol.
| Compound Name | (3R,4S)-6-chloro-2,2-dimethyl-7-nitro-4-(2-phenylethylamino)-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 70916193 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (3R,4S)-6-chloro-2,2-dimethyl-7-nitro-4-(2-phenylethylamino)-3,4-dihydrochromen-3-ol |
| SMILES | CC1(C)Oc2cc([N+](=O)[O-])c(Cl)cc2[C@H](NCCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C19H21ClN2O4/c1-19(2)18(23)17(21-9-8-12-6-4-3-5-7-12)13-10-14(20)15(22(24)25)11-16(13)26-19/h3-7,10-11,17-18,21,23H,8-9H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | QPTWPJKWLKYFFL-ZWKOTPCHSA-N |
| XLogP | 3.65 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|