C21H27BrN2O4 — CID 143093981
6-bromo-2,2-dimethyl-7-nitro-3,4-dihydrochromen-3-ol;ethene;2-phenylethanamine (PubChem CID 143093981) has the molecular formula C21H27BrN2O4 and a molecular weight of 451.36 g/mol. Its IUPAC name is 6-bromo-2,2-dimethyl-7-nitro-3,4-dihydrochromen-3-ol;ethene;2-phenylethanamine.
| Compound Name | 6-bromo-2,2-dimethyl-7-nitro-3,4-dihydrochromen-3-ol;ethene;2-phenylethanamine |
|---|---|
| PubChem CID | 143093981 |
| Molecular Formula | C21H27BrN2O4 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 6-bromo-2,2-dimethyl-7-nitro-3,4-dihydrochromen-3-ol;ethene;2-phenylethanamine |
| SMILES | C=C.CC1(C)Oc2cc([N+](=O)[O-])c(Br)cc2CC1O.NCCc1ccccc1 |
| InChI | InChI=1S/C11H12BrNO4.C8H11N.C2H4/c1-11(2)10(14)4-6-3-7(12)8(13(15)16)5-9(6)17-11;9-7-6-8-4-2-1-3-5-8;1-2/h3,5,10,14H,4H2,1-2H3;1-5H,6-7,9H2;1-2H2 |
| InChIKey | UBTAICDGOPEIDG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|