C22H24ClN3O2 — CID 11553035
7-chloro-2,2,9-trimethyl-4-(2-pyridin-4-ylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol (PubChem CID 11553035) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 7-chloro-2,2,9-trimethyl-4-(2-pyridin-4-ylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol.
| Compound Name | 7-chloro-2,2,9-trimethyl-4-(2-pyridin-4-ylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
|---|---|
| PubChem CID | 11553035 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 7-chloro-2,2,9-trimethyl-4-(2-pyridin-4-ylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
| SMILES | Cc1cc(Cl)nc2cc3c(cc12)OC(C)(C)C(O)C3NCCc1ccncc1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-13-10-19(23)26-17-11-16-18(12-15(13)17)28-22(2,3)21(27)20(16)25-9-6-14-4-7-24-8-5-14/h4-5,7-8,10-12,20-21,25,27H,6,9H2,1-3H3 |
| InChIKey | MXIJWHXNCBQJHS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|