C23H23ClN2O4 — CID 87450426
(3R,4S)-4-(1,3-benzodioxol-5-ylmethylamino)-7-chloro-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol (PubChem CID 87450426) has the molecular formula C23H23ClN2O4 and a molecular weight of 426.90 g/mol. Its IUPAC name is (3R,4S)-4-(1,3-benzodioxol-5-ylmethylamino)-7-chloro-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol.
| Compound Name | (3R,4S)-4-(1,3-benzodioxol-5-ylmethylamino)-7-chloro-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
|---|---|
| PubChem CID | 87450426 |
| Molecular Formula | C23H23ClN2O4 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (3R,4S)-4-(1,3-benzodioxol-5-ylmethylamino)-7-chloro-2,2,9-trimethyl-3,4-dihydropyrano[2,3-g]quinolin-3-ol |
| SMILES | Cc1cc(Cl)nc2cc3c(cc12)OC(C)(C)[C@H](O)[C@H]3NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H23ClN2O4/c1-12-6-20(24)26-16-8-15-18(9-14(12)16)30-23(2,3)22(27)21(15)25-10-13-4-5-17-19(7-13)29-11-28-17/h4-9,21-22,25,27H,10-11H2,1-3H3/t21-,22+/m0/s1 |
| InChIKey | LGIXAJJEPAQTJA-FCHUYYIVSA-N |
| XLogP | 4.29 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|