C16H25NO — CID 79828950
2-[(2,2-dimethylcyclohexyl)amino]-1-phenylethanol (PubChem CID 79828950) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 2-[(2,2-dimethylcyclohexyl)amino]-1-phenylethanol.
| Compound Name | 2-[(2,2-dimethylcyclohexyl)amino]-1-phenylethanol |
|---|---|
| PubChem CID | 79828950 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-[(2,2-dimethylcyclohexyl)amino]-1-phenylethanol |
| SMILES | CC1(C)CCCCC1NCC(O)c1ccccc1 |
| InChI | InChI=1S/C16H25NO/c1-16(2)11-7-6-10-15(16)17-12-14(18)13-8-4-3-5-9-13/h3-5,8-9,14-15,17-18H,6-7,10-12H2,1-2H3 |
| InChIKey | GSSUHVJUEZSURF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |