C16H24BrNO — CID 79870628
1-(3-bromophenyl)-2-[(2,2-dimethylcyclohexyl)amino]ethanol (PubChem CID 79870628) has the molecular formula C16H24BrNO and a molecular weight of 326.28 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-[(2,2-dimethylcyclohexyl)amino]ethanol.
| Compound Name | 1-(3-bromophenyl)-2-[(2,2-dimethylcyclohexyl)amino]ethanol |
|---|---|
| PubChem CID | 79870628 |
| Molecular Formula | C16H24BrNO |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 1-(3-bromophenyl)-2-[(2,2-dimethylcyclohexyl)amino]ethanol |
| SMILES | CC1(C)CCCCC1NCC(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H24BrNO/c1-16(2)9-4-3-8-15(16)18-11-14(19)12-6-5-7-13(17)10-12/h5-7,10,14-15,18-19H,3-4,8-9,11H2,1-2H3 |
| InChIKey | QGPXVDBQVODSLB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |