C20H31BrClNO — CID 11596858
1-[1-(3-bromophenyl)-2-(cyclohexylamino)ethyl]cyclohexan-1-ol;hydrochloride (PubChem CID 11596858) has the molecular formula C20H31BrClNO and a molecular weight of 416.83 g/mol. Its IUPAC name is 1-[1-(3-bromophenyl)-2-(cyclohexylamino)ethyl]cyclohexan-1-ol;hydrochloride.
| Compound Name | 1-[1-(3-bromophenyl)-2-(cyclohexylamino)ethyl]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 11596858 |
| Molecular Formula | C20H31BrClNO |
| Molecular Weight | 416.83 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 1-[1-(3-bromophenyl)-2-(cyclohexylamino)ethyl]cyclohexan-1-ol;hydrochloride |
| SMILES | Cl.OC1(C(CNC2CCCCC2)c2cccc(Br)c2)CCCCC1 |
| InChI | InChI=1S/C20H30BrNO.ClH/c21-17-9-7-8-16(14-17)19(20(23)12-5-2-6-13-20)15-22-18-10-3-1-4-11-18;/h7-9,14,18-19,22-23H,1-6,10-13,15H2;1H |
| InChIKey | CBKUEJQKYWWJIR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.83 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |