C13H21NOS — CID 79861440
2-[(2,2-dimethylcyclopentyl)amino]-1-thiophen-2-ylethanol (PubChem CID 79861440) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is 2-[(2,2-dimethylcyclopentyl)amino]-1-thiophen-2-ylethanol.
| Compound Name | 2-[(2,2-dimethylcyclopentyl)amino]-1-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 79861440 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-[(2,2-dimethylcyclopentyl)amino]-1-thiophen-2-ylethanol |
| SMILES | CC1(C)CCCC1NCC(O)c1cccs1 |
| InChI | InChI=1S/C13H21NOS/c1-13(2)7-3-6-12(13)14-9-10(15)11-5-4-8-16-11/h4-5,8,10,12,14-15H,3,6-7,9H2,1-2H3 |
| InChIKey | VMTMCJVYJFEMBS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |