C18H29NO2 — CID 79870746
1-[(2,2-dimethylcyclopentyl)amino]-3-(1-phenylethoxy)propan-2-ol (PubChem CID 79870746) has the molecular formula C18H29NO2 and a molecular weight of 291.43 g/mol. Its IUPAC name is 1-[(2,2-dimethylcyclopentyl)amino]-3-(1-phenylethoxy)propan-2-ol.
| Compound Name | 1-[(2,2-dimethylcyclopentyl)amino]-3-(1-phenylethoxy)propan-2-ol |
|---|---|
| PubChem CID | 79870746 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 1-[(2,2-dimethylcyclopentyl)amino]-3-(1-phenylethoxy)propan-2-ol |
| SMILES | CC(OCC(O)CNC1CCCC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H29NO2/c1-14(15-8-5-4-6-9-15)21-13-16(20)12-19-17-10-7-11-18(17,2)3/h4-6,8-9,14,16-17,19-20H,7,10-13H2,1-3H3 |
| InChIKey | VAYFELJVXWAXDS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |