C20H30N2O4 — CID 22826406
(3R,4S)-4-(4,4-diethoxybutylamino)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile (PubChem CID 22826406) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is (3R,4S)-4-(4,4-diethoxybutylamino)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile.
| Compound Name | (3R,4S)-4-(4,4-diethoxybutylamino)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile |
|---|---|
| PubChem CID | 22826406 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | (3R,4S)-4-(4,4-diethoxybutylamino)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile |
| SMILES | CCOC(CCCN[C@H]1c2cc(C#N)ccc2OC(C)(C)[C@@H]1O)OCC |
| InChI | InChI=1S/C20H30N2O4/c1-5-24-17(25-6-2)8-7-11-22-18-15-12-14(13-21)9-10-16(15)26-20(3,4)19(18)23/h9-10,12,17-19,22-23H,5-8,11H2,1-4H3/t18-,19+/m0/s1 |
| InChIKey | UIABGMAGBYPVNR-RBUKOAKNSA-N |
| XLogP | 2.90 |
| TPSA | 83.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|