C19H18N4O4S2 — CID 59135642
N-[2-(5-formyl-4,5-dihydro-1,3-thiazol-2-yl)-5-methoxy-1H-indol-7-yl]-N-methylpyridine-2-sulfonamide (PubChem CID 59135642) has the molecular formula C19H18N4O4S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[2-(5-formyl-4,5-dihydro-1,3-thiazol-2-yl)-5-methoxy-1H-indol-7-yl]-N-methylpyridine-2-sulfonamide.
| Compound Name | N-[2-(5-formyl-4,5-dihydro-1,3-thiazol-2-yl)-5-methoxy-1H-indol-7-yl]-N-methylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 59135642 |
| Molecular Formula | C19H18N4O4S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | N-[2-(5-formyl-4,5-dihydro-1,3-thiazol-2-yl)-5-methoxy-1H-indol-7-yl]-N-methylpyridine-2-sulfonamide |
| SMILES | COc1cc(N(C)S(=O)(=O)c2ccccn2)c2[nH]c(C3=NCC(C=O)S3)cc2c1 |
| InChI | InChI=1S/C19H18N4O4S2/c1-23(29(25,26)17-5-3-4-6-20-17)16-9-13(27-2)7-12-8-15(22-18(12)16)19-21-10-14(11-24)28-19/h3-9,11,14,22H,10H2,1-2H3 |
| InChIKey | CLWWWJCMWONHBJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|