C28H36N6O6S3 — CID 59136079
N-[2-[5-[(4-acetylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-thiazol-2-yl]-5-(3-methylperoxysulfanylpropoxy)-1H-indol-7-yl]-N-methylpyridine-2-sulfonamide (PubChem CID 59136079) has the molecular formula C28H36N6O6S3 and a molecular weight of 648.83 g/mol. Its IUPAC name is N-[2-[5-[(4-acetylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-thiazol-2-yl]-5-(3-methylperoxysulfanylpropoxy)-1H-indol-7-yl]-N-methylpyridine-2-sulfonamide.
| Compound Name | N-[2-[5-[(4-acetylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-thiazol-2-yl]-5-(3-methylperoxysulfanylpropoxy)-1H-indol-7-yl]-N-methylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 59136079 |
| Molecular Formula | C28H36N6O6S3 |
| Molecular Weight | 648.83 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | N-[2-[5-[(4-acetylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-thiazol-2-yl]-5-(3-methylperoxysulfanylpropoxy)-1H-indol-7-yl]-N-methylpyridine-2-sulfonamide |
| SMILES | COOSCCCOc1cc(N(C)S(=O)(=O)c2ccccn2)c2[nH]c(C3=NCC(CN4CCN(C(C)=O)CC4)S3)cc2c1 |
| InChI | InChI=1S/C28H36N6O6S3/c1-20(35)34-11-9-33(10-12-34)19-23-18-30-28(42-23)24-16-21-15-22(39-13-6-14-41-40-38-3)17-25(27(21)31-24)32(2)43(36,37)26-7-4-5-8-29-26/h4-5,7-8,15-17,23,31H,6,9-14,18-19H2,1-3H3 |
| InChIKey | JVKGHRBVKQOIEX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 129.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.83 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|