C11H18N2O4 — CID 59136309
methyl 3-[(1-methylpyrrolidine-2-carbonyl)amino]-4-oxobutanoate (PubChem CID 59136309) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl 3-[(1-methylpyrrolidine-2-carbonyl)amino]-4-oxobutanoate.
| Compound Name | methyl 3-[(1-methylpyrrolidine-2-carbonyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 59136309 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | methyl 3-[(1-methylpyrrolidine-2-carbonyl)amino]-4-oxobutanoate |
| SMILES | COC(=O)CC(C=O)NC(=O)C1CCCN1C |
| InChI | InChI=1S/C11H18N2O4/c1-13-5-3-4-9(13)11(16)12-8(7-14)6-10(15)17-2/h7-9H,3-6H2,1-2H3,(H,12,16) |
| InChIKey | DHHHNXGESYJNHK-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|