C12H21N2O3- — CID 169278462
(2S)-4-methyl-2-[[(2S)-1-methylpyrrolidine-2-carbonyl]amino]pentanoate (PubChem CID 169278462) has the molecular formula C12H21N2O3- and a molecular weight of 241.31 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[(2S)-1-methylpyrrolidine-2-carbonyl]amino]pentanoate.
| Compound Name | (2S)-4-methyl-2-[[(2S)-1-methylpyrrolidine-2-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 169278462 |
| Molecular Formula | C12H21N2O3- |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | (2S)-4-methyl-2-[[(2S)-1-methylpyrrolidine-2-carbonyl]amino]pentanoate |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]1CCCN1C)C(=O)[O-] |
| InChI | InChI=1S/C12H22N2O3/c1-8(2)7-9(12(16)17)13-11(15)10-5-4-6-14(10)3/h8-10H,4-7H2,1-3H3,(H,13,15)(H,16,17)/p-1/t9-,10-/m0/s1 |
| InChIKey | GWZQULDPCCCPOP-UWVGGRQHSA-M |
| XLogP | -0.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |